About 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone
1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone (PubChem CID 134884399) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone.
Molecular Properties
| Compound Name | 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone |
| PubChem CID | 134884399 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone |
| SMILES | O=C(CO)C1=c2ccccc2=CCC1 |
| InChI | InChI=1S/C12H12O2/c13-8-12(14)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4-6,13H,3,7-8H2 |
| InChIKey | OCZBGHYAIOVYAX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone?
The IUPAC name of 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone (CID 134884399) is 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone.
What is the SMILES notation for 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone?
The canonical SMILES for 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone is O=C(CO)C1=c2ccccc2=CCC1.
What is the InChIKey of 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone?
The InChIKey is OCZBGHYAIOVYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c13-8-12(14)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4-6,13H,3,7-8H2.
What are the key properties of 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone?
1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone has a molecular weight of 188.23 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydronaphthalen-1-yl)-2-hydroxyethanone is sourced from PubChem (CID 134884399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).