C17H26F3NO3Si — CID 134884413
N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 134884413) has the molecular formula C17H26F3NO3Si and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 134884413 |
| Molecular Formula | C17H26F3NO3Si |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@H](CO)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H26F3NO3Si/c1-16(2,3)25(4,5)24-14(12-9-7-6-8-10-12)13(11-22)21-15(23)17(18,19)20/h6-10,13-14,22H,11H2,1-5H3,(H,21,23)/t13-,14-/m0/s1 |
| InChIKey | QMVLUHOXDXWGAL-KBPBESRZSA-N |
| XLogP | 3.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|