C32H46N2O10 — CID 134884425
ditert-butyl 9,12,15,18,21,24-hexaoxa-2,3-diazatricyclo[23.3.1.14,8]triaconta-1(29),4(30),5,7,25,27-hexaene-2,3-dicarboxylate (PubChem CID 134884425) has the molecular formula C32H46N2O10 and a molecular weight of 618.72 g/mol. Its IUPAC name is ditert-butyl 9,12,15,18,21,24-hexaoxa-2,3-diazatricyclo[23.3.1.14,8]triaconta-1(29),4(30),5,7,25,27-hexaene-2,3-dicarboxylate.
| Compound Name | ditert-butyl 9,12,15,18,21,24-hexaoxa-2,3-diazatricyclo[23.3.1.14,8]triaconta-1(29),4(30),5,7,25,27-hexaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134884425 |
| Molecular Formula | C32H46N2O10 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | ditert-butyl 9,12,15,18,21,24-hexaoxa-2,3-diazatricyclo[23.3.1.14,8]triaconta-1(29),4(30),5,7,25,27-hexaene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2cccc(c2)OCCOCCOCCOCCOCCOc2cccc(c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H46N2O10/c1-31(2,3)43-29(35)33-25-9-7-11-27(23-25)41-21-19-39-17-15-37-13-14-38-16-18-40-20-22-42-28-12-8-10-26(24-28)34(33)30(36)44-32(4,5)6/h7-12,23-24H,13-22H2,1-6H3 |
| InChIKey | VOQKAZSUALQCKI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |