C30H42N2O9 — CID 134884461
ditert-butyl 9,12,15,18,21-pentaoxa-2,3-diazatricyclo[20.3.1.14,8]heptacosa-1(26),4(27),5,7,22,24-hexaene-2,3-dicarboxylate (PubChem CID 134884461) has the molecular formula C30H42N2O9 and a molecular weight of 574.67 g/mol. Its IUPAC name is ditert-butyl 9,12,15,18,21-pentaoxa-2,3-diazatricyclo[20.3.1.14,8]heptacosa-1(26),4(27),5,7,22,24-hexaene-2,3-dicarboxylate.
| Compound Name | ditert-butyl 9,12,15,18,21-pentaoxa-2,3-diazatricyclo[20.3.1.14,8]heptacosa-1(26),4(27),5,7,22,24-hexaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134884461 |
| Molecular Formula | C30H42N2O9 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | ditert-butyl 9,12,15,18,21-pentaoxa-2,3-diazatricyclo[20.3.1.14,8]heptacosa-1(26),4(27),5,7,22,24-hexaene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2cccc(c2)OCCOCCOCCOCCOc2cccc(c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H42N2O9/c1-29(2,3)40-27(33)31-23-9-7-11-25(21-23)38-19-17-36-15-13-35-14-16-37-18-20-39-26-12-8-10-24(22-26)32(31)28(34)41-30(4,5)6/h7-12,21-22H,13-20H2,1-6H3 |
| InChIKey | XJQSVCUNXFOURF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 105.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |