C16H24O3 — CID 134884569
(2R,5E,6R)-2-tert-butyl-5-hept-2-ynylidene-6-methyl-1,3-dioxan-4-one (PubChem CID 134884569) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2R,5E,6R)-2-tert-butyl-5-hept-2-ynylidene-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5E,6R)-2-tert-butyl-5-hept-2-ynylidene-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 134884569 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R,5E,6R)-2-tert-butyl-5-hept-2-ynylidene-6-methyl-1,3-dioxan-4-one |
| SMILES | CCCCC#C/C=C1/C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C16H24O3/c1-6-7-8-9-10-11-13-12(2)18-15(16(3,4)5)19-14(13)17/h11-12,15H,6-8H2,1-5H3/b13-11+/t12-,15-/m1/s1 |
| InChIKey | GNLKTGDJRBXTBB-LDGMUZPGSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|