C18H25NO2 — CID 134884631
N-[(2R)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]acetamide (PubChem CID 134884631) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N-[(2R)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]acetamide.
| Compound Name | N-[(2R)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 134884631 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[(2R)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](COCc1ccccc1)C(C)=C=CC(C)C |
| InChI | InChI=1S/C18H25NO2/c1-14(2)10-11-15(3)18(19-16(4)20)13-21-12-17-8-6-5-7-9-17/h5-10,14,18H,12-13H2,1-4H3,(H,19,20)/t11?,18-/m0/s1 |
| InChIKey | IYQHXXGDHGDGFC-MCEAHNFKSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |