About 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one
3-ethyl-4-propyl-1,4-dihydropyrazol-5-one (PubChem CID 134884707) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one |
| PubChem CID | 134884707 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one |
| SMILES | CCCC1C(=O)NN=C1CC |
| InChI | InChI=1S/C8H14N2O/c1-3-5-6-7(4-2)9-10-8(6)11/h6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | XERRGCLOFCHXGR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one?
The IUPAC name of 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one (CID 134884707) is 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one is CCCC1C(=O)NN=C1CC.
What is the InChIKey of 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one?
The InChIKey is XERRGCLOFCHXGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-3-5-6-7(4-2)9-10-8(6)11/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one?
3-ethyl-4-propyl-1,4-dihydropyrazol-5-one has a molecular weight of 154.21 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-propyl-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 134884707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).