C16H21F3O3 — CID 134884713
(2R,5E,6S)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-(trifluoromethyl)-1,3-dioxan-4-one (PubChem CID 134884713) has the molecular formula C16H21F3O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is (2R,5E,6S)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-(trifluoromethyl)-1,3-dioxan-4-one.
| Compound Name | (2R,5E,6S)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-(trifluoromethyl)-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 134884713 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (2R,5E,6S)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-(trifluoromethyl)-1,3-dioxan-4-one |
| SMILES | CC(C)(C)C#C/C=C1/C(=O)O[C@H](C(C)(C)C)O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C16H21F3O3/c1-14(2,3)9-7-8-10-11(16(17,18)19)21-13(15(4,5)6)22-12(10)20/h8,11,13H,1-6H3/b10-8+/t11-,13+/m0/s1 |
| InChIKey | QCCAQVCXBYIVCI-YRFMYUJQSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|