C17H24O2 — CID 134884817
ethyl (2S)-2-methyl-5-(2-methylcyclobuten-1-yl)-2-prop-2-enylhexa-3,4-dienoate (PubChem CID 134884817) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is ethyl (2S)-2-methyl-5-(2-methylcyclobuten-1-yl)-2-prop-2-enylhexa-3,4-dienoate.
| Compound Name | ethyl (2S)-2-methyl-5-(2-methylcyclobuten-1-yl)-2-prop-2-enylhexa-3,4-dienoate |
|---|---|
| PubChem CID | 134884817 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | ethyl (2S)-2-methyl-5-(2-methylcyclobuten-1-yl)-2-prop-2-enylhexa-3,4-dienoate |
| SMILES | C=CC[C@@](C)(C=C=C(C)C1=C(C)CC1)C(=O)OCC |
| InChI | InChI=1S/C17H24O2/c1-6-11-17(5,16(18)19-7-2)12-10-14(4)15-9-8-13(15)3/h6,12H,1,7-9,11H2,2-5H3/t10?,17-/m0/s1 |
| InChIKey | QXXFIBWOFHJYBD-LKDXBUKQSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|