C24H18 — CID 134885006
1-ethynyl-2-[4-(2-ethynyl-4,5-dimethylphenyl)buta-1,3-diynyl]-4,5-dimethylbenzene (PubChem CID 134885006) has the molecular formula C24H18 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-ethynyl-2-[4-(2-ethynyl-4,5-dimethylphenyl)buta-1,3-diynyl]-4,5-dimethylbenzene.
| Compound Name | 1-ethynyl-2-[4-(2-ethynyl-4,5-dimethylphenyl)buta-1,3-diynyl]-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 134885006 |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-ethynyl-2-[4-(2-ethynyl-4,5-dimethylphenyl)buta-1,3-diynyl]-4,5-dimethylbenzene |
| SMILES | C#Cc1cc(C)c(C)cc1C#CC#Cc1cc(C)c(C)cc1C#C |
| InChI | InChI=1S/C24H18/c1-7-21-13-17(3)19(5)15-23(21)11-9-10-12-24-16-20(6)18(4)14-22(24)8-2/h1-2,13-16H,3-6H3 |
| InChIKey | LULPECZDXRVDBX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|