C19H31IO7Si — CID 134885086
2-[(2S,3R,4S,5R,6S)-6-(2-iodoethynyl)-4,5-bis(methoxymethoxy)-2-(methoxymethoxymethyl)oxan-3-yl]ethynyl-trimethylsilane (PubChem CID 134885086) has the molecular formula C19H31IO7Si and a molecular weight of 526.44 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R,6S)-6-(2-iodoethynyl)-4,5-bis(methoxymethoxy)-2-(methoxymethoxymethyl)oxan-3-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2S,3R,4S,5R,6S)-6-(2-iodoethynyl)-4,5-bis(methoxymethoxy)-2-(methoxymethoxymethyl)oxan-3-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 134885086 |
| Molecular Formula | C19H31IO7Si |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 2-[(2S,3R,4S,5R,6S)-6-(2-iodoethynyl)-4,5-bis(methoxymethoxy)-2-(methoxymethoxymethyl)oxan-3-yl]ethynyl-trimethylsilane |
| SMILES | COCOC[C@H]1O[C@@H](C#CI)[C@H](OCOC)[C@@H](OCOC)[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H31IO7Si/c1-21-12-24-11-17-15(8-10-28(4,5)6)18(25-13-22-2)19(26-14-23-3)16(27-17)7-9-20/h15-19H,11-14H2,1-6H3/t15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | GNVFHWNETHHMLX-LFDJNIOPSA-N |
| XLogP | 2.25 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|