C30H51B — CID 134885096
tris[[(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane (PubChem CID 134885096) has the molecular formula C30H51B and a molecular weight of 422.55 g/mol. Its IUPAC name is tris[[(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane.
| Compound Name | tris[[(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane |
|---|---|
| PubChem CID | 134885096 |
| Molecular Formula | C30H51B |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.41 |
| IUPAC Name | tris[[(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane |
| SMILES | CC1(C)[C@@H]2CC[C@@H](CB(C[C@@H]3CC[C@@H]4C[C@H]3C4(C)C)C[C@@H]3CC[C@@H]4C[C@H]3C4(C)C)[C@H]1C2 |
| InChI | InChI=1S/C30H51B/c1-28(2)22-10-7-19(25(28)13-22)16-31(17-20-8-11-23-14-26(20)29(23,3)4)18-21-9-12-24-15-27(21)30(24,5)6/h19-27H,7-18H2,1-6H3/t19-,20-,21-,22+,23+,24+,25+,26+,27+/m0/s1 |
| InChIKey | DSJLJZCYWBDQAF-PWRNOJCPSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|