C38H42Si2 — CID 134885104
2-[5-tert-butyl-2-[8-[4-tert-butyl-2-(2-trimethylsilylethynyl)phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-trimethylsilane (PubChem CID 134885104) has the molecular formula C38H42Si2 and a molecular weight of 554.93 g/mol. Its IUPAC name is 2-[5-tert-butyl-2-[8-[4-tert-butyl-2-(2-trimethylsilylethynyl)phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[5-tert-butyl-2-[8-[4-tert-butyl-2-(2-trimethylsilylethynyl)phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 134885104 |
| Molecular Formula | C38H42Si2 |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 2-[5-tert-butyl-2-[8-[4-tert-butyl-2-(2-trimethylsilylethynyl)phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)c1ccc(C#CC#CC#CC#Cc2ccc(C(C)(C)C)cc2C#C[Si](C)(C)C)c(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C38H42Si2/c1-37(2,3)35-23-21-31(33(29-35)25-27-39(7,8)9)19-17-15-13-14-16-18-20-32-22-24-36(38(4,5)6)30-34(32)26-28-40(10,11)12/h21-24,29-30H,1-12H3 |
| InChIKey | LUKHPOYMXKBNHY-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|