C26H44O3Si2 — CID 134885137
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1-[(Z)-7-methoxyhept-3-en-1,5-diynyl]cyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 134885137) has the molecular formula C26H44O3Si2 and a molecular weight of 460.81 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1-[(Z)-7-methoxyhept-3-en-1,5-diynyl]cyclohex-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1-[(Z)-7-methoxyhept-3-en-1,5-diynyl]cyclohex-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134885137 |
| Molecular Formula | C26H44O3Si2 |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1-[(Z)-7-methoxyhept-3-en-1,5-diynyl]cyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | COCC#C/C=C\C#CC1(O[Si](C)(C)C(C)(C)C)CCC=CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O3Si2/c1-24(2,3)30(8,9)28-23-19-15-17-21-26(23,29-31(10,11)25(4,5)6)20-16-13-12-14-18-22-27-7/h12-13,15,19,23H,17,21-22H2,1-11H3/b13-12- |
| InChIKey | NTNRGKSNLMQFQL-SEYXRHQNSA-N |
| XLogP | 6.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|