C29H28NOP — CID 134885141
5,5,5-triphenyl-3-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphole (PubChem CID 134885141) has the molecular formula C29H28NOP and a molecular weight of 437.52 g/mol. Its IUPAC name is 5,5,5-triphenyl-3-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphole.
| Compound Name | 5,5,5-triphenyl-3-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphole |
|---|---|
| PubChem CID | 134885141 |
| Molecular Formula | C29H28NOP |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5,5,5-triphenyl-3-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphole |
| SMILES | Cc1cc(C)c(C2=NOP(c3ccccc3)(c3ccccc3)(c3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C29H28NOP/c1-22-19-23(2)29(24(3)20-22)28-21-32(31-30-28,25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-20H,21H2,1-3H3 |
| InChIKey | OLSUGDVNRKPWLJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|