About (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol
(3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol (PubChem CID 134885142) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol.
Molecular Properties
| Compound Name | (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol |
| PubChem CID | 134885142 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol |
| SMILES | CC(O)/C=C/C#CC=C=C1CCCCC1 |
| InChI | InChI=1S/C14H18O/c1-13(15)9-5-2-3-6-10-14-11-7-4-8-12-14/h5-6,9,13,15H,4,7-8,11-12H2,1H3/b9-5+ |
| InChIKey | LLIMUGMXPHNWRQ-WEVVVXLNSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol?
The IUPAC name of (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol (CID 134885142) is (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol.
What is the SMILES notation for (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol?
The canonical SMILES for (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol is CC(O)/C=C/C#CC=C=C1CCCCC1.
What is the InChIKey of (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol?
The InChIKey is LLIMUGMXPHNWRQ-WEVVVXLNSA-N. The full InChI is InChI=1S/C14H18O/c1-13(15)9-5-2-3-6-10-14-11-7-4-8-12-14/h5-6,9,13,15H,4,7-8,11-12H2,1H3/b9-5+.
What are the key properties of (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol?
(3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol has a molecular weight of 202.30 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-8-cyclohexylideneocta-3,7-dien-5-yn-2-ol is sourced from PubChem (CID 134885142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).