About chlorozinc(1+);trimethyl(2-phenylethynyl)silane
chlorozinc(1+);trimethyl(2-phenylethynyl)silane (PubChem CID 134885190) has the molecular formula C11H13ClSiZn
and a molecular weight of 274.15 g/mol. Its IUPAC name is chlorozinc(1+);trimethyl(2-phenylethynyl)silane.
Molecular Properties
| Compound Name | chlorozinc(1+);trimethyl(2-phenylethynyl)silane |
| PubChem CID | 134885190 |
| Molecular Formula | C11H13ClSiZn |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | chlorozinc(1+);trimethyl(2-phenylethynyl)silane |
| SMILES | C[Si](C)(C)C#Cc1[c-]cccc1.Cl[Zn+] |
| InChI | InChI=1S/C11H13Si.ClH.Zn/c1-12(2,3)10-9-11-7-5-4-6-8-11;;/h4-7H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | PNWIECRBQVITHR-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);trimethyl(2-phenylethynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);trimethyl(2-phenylethynyl)silane?
The IUPAC name of chlorozinc(1+);trimethyl(2-phenylethynyl)silane (CID 134885190) is chlorozinc(1+);trimethyl(2-phenylethynyl)silane.
What is the SMILES notation for chlorozinc(1+);trimethyl(2-phenylethynyl)silane?
The canonical SMILES for chlorozinc(1+);trimethyl(2-phenylethynyl)silane is C[Si](C)(C)C#Cc1[c-]cccc1.Cl[Zn+].
What is the InChIKey of chlorozinc(1+);trimethyl(2-phenylethynyl)silane?
The InChIKey is PNWIECRBQVITHR-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13Si.ClH.Zn/c1-12(2,3)10-9-11-7-5-4-6-8-11;;/h4-7H,1-3H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);trimethyl(2-phenylethynyl)silane?
chlorozinc(1+);trimethyl(2-phenylethynyl)silane has a molecular weight of 274.15 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);trimethyl(2-phenylethynyl)silane is sourced from PubChem (CID 134885190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).