C23H42O2Si2 — CID 134885223
tert-butyl-dimethyl-[(2E,6E)-3-methyl-1-(2-methylprop-1-enylidene)-7-trimethylsilyloxynona-2,6,8-trienoxy]silane (PubChem CID 134885223) has the molecular formula C23H42O2Si2 and a molecular weight of 406.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,6E)-3-methyl-1-(2-methylprop-1-enylidene)-7-trimethylsilyloxynona-2,6,8-trienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,6E)-3-methyl-1-(2-methylprop-1-enylidene)-7-trimethylsilyloxynona-2,6,8-trienoxy]silane |
|---|---|
| PubChem CID | 134885223 |
| Molecular Formula | C23H42O2Si2 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,6E)-3-methyl-1-(2-methylprop-1-enylidene)-7-trimethylsilyloxynona-2,6,8-trienoxy]silane |
| SMILES | C=C/C(=C\CC/C(C)=C/C(=C=C(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H42O2Si2/c1-13-21(24-26(8,9)10)16-14-15-20(4)18-22(17-19(2)3)25-27(11,12)23(5,6)7/h13,16,18H,1,14-15H2,2-12H3/b20-18+,21-16+ |
| InChIKey | ZUBZDPWOAKYOBM-JPJLSXHTSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|