About (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol
(4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol (PubChem CID 134885285) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol.
Molecular Properties
| Compound Name | (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol |
| PubChem CID | 134885285 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol |
| SMILES | C/C=C/CC#CC(C)CC(O)/C=C/CCCOC1CCCCO1 |
| InChI | InChI=1S/C20H32O3/c1-3-4-5-7-12-18(2)17-19(21)13-8-6-10-15-22-20-14-9-11-16-23-20/h3-4,8,13,18-21H,5-6,9-11,14-17H2,1-2H3/b4-3+,13-8+ |
| InChIKey | KXPOCEQDVQDBSA-JRWPLQFESA-N |
| XLogP | 4.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol?
The IUPAC name of (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol (CID 134885285) is (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol.
What is the SMILES notation for (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol?
The canonical SMILES for (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol is C/C=C/CC#CC(C)CC(O)/C=C/CCCOC1CCCCO1.
What is the InChIKey of (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol?
The InChIKey is KXPOCEQDVQDBSA-JRWPLQFESA-N. The full InChI is InChI=1S/C20H32O3/c1-3-4-5-7-12-18(2)17-19(21)13-8-6-10-15-22-20-14-9-11-16-23-20/h3-4,8,13,18-21H,5-6,9-11,14-17H2,1-2H3/b4-3+,13-8+.
What are the key properties of (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol?
(4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol has a molecular weight of 320.47 g/mol, XLogP of 4.22, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,12-dien-9-yn-6-ol is sourced from PubChem (CID 134885285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).