About tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane
tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane (PubChem CID 134885317) has the molecular formula C19H28Si
and a molecular weight of 284.52 g/mol. Its IUPAC name is tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane.
Molecular Properties
| Compound Name | tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane |
| PubChem CID | 134885317 |
| Molecular Formula | C19H28Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane |
| SMILES | C#CC#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(C)C |
| InChI | InChI=1S/C19H28Si/c1-10-11-12-19(15(2)3)13-14-20(16(4)5,17(6)7)18(8)9/h1,16-18H,2-9H3 |
| InChIKey | XUSGWSCDPRCRMH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane?
The IUPAC name of tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane (CID 134885317) is tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane.
What is the SMILES notation for tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane?
The canonical SMILES for tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane is C#CC#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(C)C.
What is the InChIKey of tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane?
The InChIKey is XUSGWSCDPRCRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28Si/c1-10-11-12-19(15(2)3)13-14-20(16(4)5,17(6)7)18(8)9/h1,16-18H,2-9H3.
What are the key properties of tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane?
tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane has a molecular weight of 284.52 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)-(3-propan-2-ylidenehepta-1,4,6-triynyl)silane is sourced from PubChem (CID 134885317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).