About 2-propa-1,2-dienoxyprop-1-ene
2-propa-1,2-dienoxyprop-1-ene (PubChem CID 134885348) has the molecular formula C6H8O
and a molecular weight of 96.13 g/mol. Its IUPAC name is 2-propa-1,2-dienoxyprop-1-ene.
Molecular Properties
| Compound Name | 2-propa-1,2-dienoxyprop-1-ene |
| PubChem CID | 134885348 |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.06 |
| IUPAC Name | 2-propa-1,2-dienoxyprop-1-ene |
| SMILES | C=C=COC(=C)C |
| InChI | InChI=1S/C6H8O/c1-4-5-7-6(2)3/h5H,1-2H2,3H3 |
| InChIKey | ZDELUQCINDMAJK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-propa-1,2-dienoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propa-1,2-dienoxyprop-1-ene?
The IUPAC name of 2-propa-1,2-dienoxyprop-1-ene (CID 134885348) is 2-propa-1,2-dienoxyprop-1-ene.
What is the SMILES notation for 2-propa-1,2-dienoxyprop-1-ene?
The canonical SMILES for 2-propa-1,2-dienoxyprop-1-ene is C=C=COC(=C)C.
What is the InChIKey of 2-propa-1,2-dienoxyprop-1-ene?
The InChIKey is ZDELUQCINDMAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O/c1-4-5-7-6(2)3/h5H,1-2H2,3H3.
What are the key properties of 2-propa-1,2-dienoxyprop-1-ene?
2-propa-1,2-dienoxyprop-1-ene has a molecular weight of 96.13 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propa-1,2-dienoxyprop-1-ene is sourced from PubChem (CID 134885348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).