C10H16S — CID 134885469
3-[(E)-prop-1-enyl]sulfanylhepta-1,2-diene (PubChem CID 134885469) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 3-[(E)-prop-1-enyl]sulfanylhepta-1,2-diene.
| Compound Name | 3-[(E)-prop-1-enyl]sulfanylhepta-1,2-diene |
|---|---|
| PubChem CID | 134885469 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-[(E)-prop-1-enyl]sulfanylhepta-1,2-diene |
| SMILES | C=C=C(CCCC)S/C=C/C |
| InChI | InChI=1S/C10H16S/c1-4-7-8-10(6-3)11-9-5-2/h5,9H,3-4,7-8H2,1-2H3/b9-5+ |
| InChIKey | AQKJHUWHJXSYEY-WEVVVXLNSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |