C20H19O11PW — CID 134885847
carbon monoxide;7-O-ethyl 2-O,3-O-dimethyl 5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate;tungsten (PubChem CID 134885847) has the molecular formula C20H19O11PW and a molecular weight of 650.17 g/mol. Its IUPAC name is carbon monoxide;7-O-ethyl 2-O,3-O-dimethyl 5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate;tungsten.
| Compound Name | carbon monoxide;7-O-ethyl 2-O,3-O-dimethyl 5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate;tungsten |
|---|---|
| PubChem CID | 134885847 |
| Molecular Formula | C20H19O11PW |
| Molecular Weight | 650.17 g/mol |
| Exact Mass | 650.02 |
| IUPAC Name | carbon monoxide;7-O-ethyl 2-O,3-O-dimethyl 5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate;tungsten |
| SMILES | CCOC(=O)P1C2C(C)=C(C)C1C(C(=O)OC)=C2C(=O)OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C15H19O6P.5CO.W/c1-6-21-15(18)22-11-7(2)8(3)12(22)10(14(17)20-5)9(11)13(16)19-4;5*1-2;/h11-12H,6H2,1-5H3;;;;;; |
| InChIKey | REXMZDVDTNZKHB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 178.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|