About 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine
4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine (PubChem CID 134886016) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine |
| PubChem CID | 134886016 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine |
| SMILES | C=C(OCC)/C(=C/C(C[N+](=O)[O-])c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H24N2O4/c1-3-24-15(2)18(19-9-11-23-12-10-19)13-17(14-20(21)22)16-7-5-4-6-8-16/h4-8,13,17H,2-3,9-12,14H2,1H3/b18-13- |
| InChIKey | RZEJCMHIQMNZAV-AQTBWJFISA-N |
| XLogP | 2.81 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine?
The IUPAC name of 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine (CID 134886016) is 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine.
What is the SMILES notation for 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine?
The canonical SMILES for 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine is C=C(OCC)/C(=C/C(C[N+](=O)[O-])c1ccccc1)N1CCOCC1.
What is the InChIKey of 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine?
The InChIKey is RZEJCMHIQMNZAV-AQTBWJFISA-N. The full InChI is InChI=1S/C18H24N2O4/c1-3-24-15(2)18(19-9-11-23-12-10-19)13-17(14-20(21)22)16-7-5-4-6-8-16/h4-8,13,17H,2-3,9-12,14H2,1H3/b18-13-.
What are the key properties of 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine?
4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine has a molecular weight of 332.40 g/mol, XLogP of 2.81, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3Z)-2-ethoxy-6-nitro-5-phenylhexa-1,3-dien-3-yl]morpholine is sourced from PubChem (CID 134886016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).