About 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid
2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid (PubChem CID 134886024) has the molecular formula C24H25ClNO4P
and a molecular weight of 457.89 g/mol. Its IUPAC name is 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid.
Molecular Properties
| Compound Name | 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid |
| PubChem CID | 134886024 |
| Molecular Formula | C24H25ClNO4P |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid |
| SMILES | CC(NC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H25ClNO4P/c1-19(23(27)28)26-24(29)30-17-18-31(25,20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | NZNQAYXWDAFOCZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid?
The IUPAC name of 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid (CID 134886024) is 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid.
What is the SMILES notation for 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid?
The canonical SMILES for 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid is CC(NC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.
What is the InChIKey of 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid?
The InChIKey is NZNQAYXWDAFOCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25ClNO4P/c1-19(23(27)28)26-24(29)30-17-18-31(25,20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3,(H,26,29)(H,27,28).
What are the key properties of 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid?
2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid has a molecular weight of 457.89 g/mol, XLogP of 3.87, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]propanoic acid is sourced from PubChem (CID 134886024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).