C18H17CrO10P — CID 134886172
carbon monoxide;chromium;dimethyl 7-methoxy-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 134886172) has the molecular formula C18H17CrO10P and a molecular weight of 476.29 g/mol. Its IUPAC name is carbon monoxide;chromium;dimethyl 7-methoxy-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | carbon monoxide;chromium;dimethyl 7-methoxy-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134886172 |
| Molecular Formula | C18H17CrO10P |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | carbon monoxide;chromium;dimethyl 7-methoxy-5,6-dimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C(C)=C(C)C1P2OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C13H17O5P.5CO.Cr/c1-6-7(2)11-9(13(15)17-4)8(12(14)16-3)10(6)19(11)18-5;5*1-2;/h10-11H,1-5H3;;;;;; |
| InChIKey | QKMRVUSZCLMXBW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 161.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|