C16H24O4 — CID 134886282
[(2E,6E)-8-cyclohexyl-8-oxoocta-2,6-dienyl] methyl carbonate (PubChem CID 134886282) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(2E,6E)-8-cyclohexyl-8-oxoocta-2,6-dienyl] methyl carbonate.
| Compound Name | [(2E,6E)-8-cyclohexyl-8-oxoocta-2,6-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 134886282 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(2E,6E)-8-cyclohexyl-8-oxoocta-2,6-dienyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/CC/C=C/C(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H24O4/c1-19-16(18)20-13-9-4-2-3-8-12-15(17)14-10-6-5-7-11-14/h4,8-9,12,14H,2-3,5-7,10-11,13H2,1H3/b9-4+,12-8+ |
| InChIKey | PRODXDPUFJMDES-FMQHCKNKSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|