About [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate
[(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate (PubChem CID 134886332) has the molecular formula C20H28O4P2S
and a molecular weight of 426.46 g/mol. Its IUPAC name is [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate.
Molecular Properties
| Compound Name | [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate |
| PubChem CID | 134886332 |
| Molecular Formula | C20H28O4P2S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate |
| SMILES | C[C@H](CC[C@H](C)OS(=O)(=O)O)PCCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28O4P2S/c1-17(24-27(21,22)23)13-14-18(2)25-15-16-26(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,25H,13-16H2,1-2H3,(H,21,22,23)/t17-,18+/m0/s1 |
| InChIKey | VLORAIDRNSOEIY-ZWKOTPCHSA-N |
| XLogP | 4.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate?
The IUPAC name of [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate (CID 134886332) is [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate.
What is the SMILES notation for [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate?
The canonical SMILES for [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate is C[C@H](CC[C@H](C)OS(=O)(=O)O)PCCP(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate?
The InChIKey is VLORAIDRNSOEIY-ZWKOTPCHSA-N. The full InChI is InChI=1S/C20H28O4P2S/c1-17(24-27(21,22)23)13-14-18(2)25-15-16-26(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,25H,13-16H2,1-2H3,(H,21,22,23)/t17-,18+/m0/s1.
What are the key properties of [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate?
[(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate has a molecular weight of 426.46 g/mol, XLogP of 4.17, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-(2-diphenylphosphanylethylphosphanyl)hexan-2-yl] hydrogen sulfate is sourced from PubChem (CID 134886332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).