C10H16F3NO4SSi — CID 134886401
trifluoromethanesulfonate;trimethyl(pyridin-1-ium-1-ylmethoxy)silane (PubChem CID 134886401) has the molecular formula C10H16F3NO4SSi and a molecular weight of 331.39 g/mol. Its IUPAC name is trifluoromethanesulfonate;trimethyl(pyridin-1-ium-1-ylmethoxy)silane.
| Compound Name | trifluoromethanesulfonate;trimethyl(pyridin-1-ium-1-ylmethoxy)silane |
|---|---|
| PubChem CID | 134886401 |
| Molecular Formula | C10H16F3NO4SSi |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | trifluoromethanesulfonate;trimethyl(pyridin-1-ium-1-ylmethoxy)silane |
| SMILES | C[Si](C)(C)OC[n+]1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H16NOSi.CHF3O3S/c1-12(2,3)11-9-10-7-5-4-6-8-10;2-1(3,4)8(5,6)7/h4-8H,9H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XTJOYSNXAXOYSL-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|