C7H16Cl3N — CID 134886422
(2S)-1,5-dichloro-N,N-dimethylpentan-2-amine;hydrochloride (PubChem CID 134886422) has the molecular formula C7H16Cl3N and a molecular weight of 220.57 g/mol. Its IUPAC name is (2S)-1,5-dichloro-N,N-dimethylpentan-2-amine;hydrochloride.
| Compound Name | (2S)-1,5-dichloro-N,N-dimethylpentan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 134886422 |
| Molecular Formula | C7H16Cl3N |
| Molecular Weight | 220.57 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | (2S)-1,5-dichloro-N,N-dimethylpentan-2-amine;hydrochloride |
| SMILES | CN(C)[C@H](CCl)CCCCl.Cl |
| InChI | InChI=1S/C7H15Cl2N.ClH/c1-10(2)7(6-9)4-3-5-8;/h7H,3-6H2,1-2H3;1H/t7-;/m0./s1 |
| InChIKey | DUCJSMDRQOYMBP-FJXQXJEOSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|