C18H17MoO9P — CID 134886472
carbon monoxide;dimethyl 5,6,7-trimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;molybdenum (PubChem CID 134886472) has the molecular formula C18H17MoO9P and a molecular weight of 504.24 g/mol. Its IUPAC name is carbon monoxide;dimethyl 5,6,7-trimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;molybdenum.
| Compound Name | carbon monoxide;dimethyl 5,6,7-trimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;molybdenum |
|---|---|
| PubChem CID | 134886472 |
| Molecular Formula | C18H17MoO9P |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | carbon monoxide;dimethyl 5,6,7-trimethyl-7-phosphabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate;molybdenum |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C(C)=C(C)C1P2C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo] |
| InChI | InChI=1S/C13H17O4P.5CO.Mo/c1-6-7(2)11-9(13(15)17-4)8(12(14)16-3)10(6)18(11)5;5*1-2;/h10-11H,1-5H3;;;;;; |
| InChIKey | LYRSAZDPRJSQBY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 152.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|