C42H52O8Si — CID 134886617
(3S,5S,6S)-3-[(1S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)hexyl]-5,6-bis(4-methoxyphenyl)-1,4-dioxan-2-one (PubChem CID 134886617) has the molecular formula C42H52O8Si and a molecular weight of 712.96 g/mol. Its IUPAC name is (3S,5S,6S)-3-[(1S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)hexyl]-5,6-bis(4-methoxyphenyl)-1,4-dioxan-2-one.
| Compound Name | (3S,5S,6S)-3-[(1S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)hexyl]-5,6-bis(4-methoxyphenyl)-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 134886617 |
| Molecular Formula | C42H52O8Si |
| Molecular Weight | 712.96 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | (3S,5S,6S)-3-[(1S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)hexyl]-5,6-bis(4-methoxyphenyl)-1,4-dioxan-2-one |
| SMILES | COCO[C@@H](CCC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1O[C@@H](c2ccc(OC)cc2)[C@H](c2ccc(OC)cc2)OC1=O |
| InChI | InChI=1S/C42H52O8Si/c1-30(50-51(42(2,3)4,35-16-10-8-11-17-35)36-18-12-9-13-19-36)15-14-20-37(47-29-44-5)40-41(43)49-39(32-23-27-34(46-7)28-24-32)38(48-40)31-21-25-33(45-6)26-22-31/h8-13,16-19,21-28,30,37-40H,14-15,20,29H2,1-7H3/t30-,37+,38+,39+,40+/m1/s1 |
| InChIKey | MMJQZYYPHIJMRE-AQIDLCQRSA-N |
| XLogP | 7.55 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.96 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|