About [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate
[(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate (PubChem CID 134886644) has the molecular formula C29H40O3Si
and a molecular weight of 464.72 g/mol. Its IUPAC name is [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate.
Molecular Properties
| Compound Name | [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate |
| PubChem CID | 134886644 |
| Molecular Formula | C29H40O3Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](C[C@@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C29H40O3Si/c1-7-16-25(32-28(30)8-2)23-24(3)17-15-22-31-33(29(4,5)6,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h7-14,18-21,24-25H,1-2,15-17,22-23H2,3-6H3/t24-,25-/m0/s1 |
| InChIKey | BXCXRBIHWLOVEY-DQEYMECFSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate?
The IUPAC name of [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate (CID 134886644) is [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate.
What is the SMILES notation for [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate?
The canonical SMILES for [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate is C=CC[C@@H](C[C@@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)C=C.
What is the InChIKey of [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate?
The InChIKey is BXCXRBIHWLOVEY-DQEYMECFSA-N. The full InChI is InChI=1S/C29H40O3Si/c1-7-16-25(32-28(30)8-2)23-24(3)17-15-22-31-33(29(4,5)6,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h7-14,18-21,24-25H,1-2,15-17,22-23H2,3-6H3/t24-,25-/m0/s1.
What are the key properties of [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate?
[(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate has a molecular weight of 464.72 g/mol, XLogP of 6.04, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,6S)-9-[tert-butyl(diphenyl)silyl]oxy-6-methylnon-1-en-4-yl] prop-2-enoate is sourced from PubChem (CID 134886644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).