C23H44O3Si2 — CID 134886662
(4aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,4,5,6,7-hexahydro-1H-naphthalene-4a-carbaldehyde (PubChem CID 134886662) has the molecular formula C23H44O3Si2 and a molecular weight of 424.77 g/mol. Its IUPAC name is (4aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,4,5,6,7-hexahydro-1H-naphthalene-4a-carbaldehyde.
| Compound Name | (4aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,4,5,6,7-hexahydro-1H-naphthalene-4a-carbaldehyde |
|---|---|
| PubChem CID | 134886662 |
| Molecular Formula | C23H44O3Si2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (4aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,4,5,6,7-hexahydro-1H-naphthalene-4a-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=C2CCCC[C@@]2(C=O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si2/c1-21(2,3)27(7,8)25-19-15-18-13-11-12-14-23(18,17-24)16-20(19)26-28(9,10)22(4,5)6/h15,17,19-20H,11-14,16H2,1-10H3/t19?,20?,23-/m0/s1 |
| InChIKey | CHWPYCMFBYSFDR-XPJNUEMQSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|