About trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane
trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane (PubChem CID 134886673) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane.
Molecular Properties
| Compound Name | trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane |
| PubChem CID | 134886673 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane |
| SMILES | C=C[C@H]1C[C@@H]1/C=C/C |
| InChI | InChI=1S/C8H12/c1-3-5-8-6-7(8)4-2/h3-5,7-8H,2,6H2,1H3/b5-3+/t7-,8-/m0/s1 |
| InChIKey | PCTQXTPEUWPMPH-VKTMEOEOSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane?
The IUPAC name of trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane (CID 134886673) is trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane.
What is the SMILES notation for trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane?
The canonical SMILES for trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane is C=C[C@H]1C[C@@H]1/C=C/C.
What is the InChIKey of trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane?
The InChIKey is PCTQXTPEUWPMPH-VKTMEOEOSA-N. The full InChI is InChI=1S/C8H12/c1-3-5-8-6-7(8)4-2/h3-5,7-8H,2,6H2,1H3/b5-3+/t7-,8-/m0/s1.
What are the key properties of trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane?
trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane has a molecular weight of 108.18 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-ethenyl-2-[(E)-prop-1-enyl]cyclopropane is sourced from PubChem (CID 134886673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).