C8H18OSi — CID 134886688
trimethyl-[(2S,3S)-3-propyloxiran-2-yl]silane (PubChem CID 134886688) has the molecular formula C8H18OSi and a molecular weight of 158.32 g/mol. Its IUPAC name is trimethyl-[(2S,3S)-3-propyloxiran-2-yl]silane.
| Compound Name | trimethyl-[(2S,3S)-3-propyloxiran-2-yl]silane |
|---|---|
| PubChem CID | 134886688 |
| Molecular Formula | C8H18OSi |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | trimethyl-[(2S,3S)-3-propyloxiran-2-yl]silane |
| SMILES | CCC[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C8H18OSi/c1-5-6-7-8(9-7)10(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | VIDIAPCYFQODDZ-YUMQZZPRSA-N |
| XLogP | 2.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|