About S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate
S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate (PubChem CID 134886760) has the molecular formula C27H36O4SSi
and a molecular weight of 484.73 g/mol. Its IUPAC name is S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate.
Molecular Properties
| Compound Name | S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate |
| PubChem CID | 134886760 |
| Molecular Formula | C27H36O4SSi |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate |
| SMILES | CCSC(=O)C[C@@H]1CC(=O)C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H36O4SSi/c1-5-32-26(29)20-23-19-21(28)18-22(31-23)16-17-30-33(27(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,22-23H,5,16-20H2,1-4H3/t22-,23+/m1/s1 |
| InChIKey | ZLYQTONASBLXCK-PKTZIBPZSA-N |
| XLogP | 4.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate?
The IUPAC name of S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate (CID 134886760) is S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate.
What is the SMILES notation for S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate?
The canonical SMILES for S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate is CCSC(=O)C[C@@H]1CC(=O)C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1.
What is the InChIKey of S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate?
The InChIKey is ZLYQTONASBLXCK-PKTZIBPZSA-N. The full InChI is InChI=1S/C27H36O4SSi/c1-5-32-26(29)20-23-19-21(28)18-22(31-23)16-17-30-33(27(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,22-23H,5,16-20H2,1-4H3/t22-,23+/m1/s1.
What are the key properties of S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate?
S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate has a molecular weight of 484.73 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 2-[(2S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate is sourced from PubChem (CID 134886760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).