C25H47P — CID 134886762
tributyl-[(2Z,4R,6E)-2-ethyl-4,8-dimethylnona-2,6,8-trienylidene]-λ5-phosphane (PubChem CID 134886762) has the molecular formula C25H47P and a molecular weight of 378.63 g/mol. Its IUPAC name is tributyl-[(2Z,4R,6E)-2-ethyl-4,8-dimethylnona-2,6,8-trienylidene]-λ5-phosphane.
| Compound Name | tributyl-[(2Z,4R,6E)-2-ethyl-4,8-dimethylnona-2,6,8-trienylidene]-λ5-phosphane |
|---|---|
| PubChem CID | 134886762 |
| Molecular Formula | C25H47P |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.34 |
| IUPAC Name | tributyl-[(2Z,4R,6E)-2-ethyl-4,8-dimethylnona-2,6,8-trienylidene]-λ5-phosphane |
| SMILES | C=C(C)/C=C/C[C@@H](C)/C=C(\C=P(CCCC)(CCCC)CCCC)CC |
| InChI | InChI=1S/C25H47P/c1-8-12-18-26(19-13-9-2,20-14-10-3)22-25(11-4)21-24(7)17-15-16-23(5)6/h15-16,21-22,24H,5,8-14,17-20H2,1-4,6-7H3/b16-15+,25-21-/t24-/m1/s1 |
| InChIKey | HUYPIBURHYDGNM-PCIHGMOQSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|