C33H62O6Si2 — CID 134886884
4-[(1S,5S,6S)-6-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-5-methyl-2-oxocyclohex-3-en-1-yl]-4-triethylsilyloxybutanal (PubChem CID 134886884) has the molecular formula C33H62O6Si2 and a molecular weight of 611.03 g/mol. Its IUPAC name is 4-[(1S,5S,6S)-6-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-5-methyl-2-oxocyclohex-3-en-1-yl]-4-triethylsilyloxybutanal.
| Compound Name | 4-[(1S,5S,6S)-6-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-5-methyl-2-oxocyclohex-3-en-1-yl]-4-triethylsilyloxybutanal |
|---|---|
| PubChem CID | 134886884 |
| Molecular Formula | C33H62O6Si2 |
| Molecular Weight | 611.03 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | 4-[(1S,5S,6S)-6-[2-[(4R,6S)-2,2-dimethyl-6-(2-triethylsilyloxyethyl)-1,3-dioxan-4-yl]ethyl]-5-methyl-2-oxocyclohex-3-en-1-yl]-4-triethylsilyloxybutanal |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1C[C@@H](CC[C@H]2C(C)C=CC(=O)[C@@H]2C(CCC=O)O[Si](CC)(CC)CC)OC(C)(C)O1 |
| InChI | InChI=1S/C33H62O6Si2/c1-10-40(11-2,12-3)36-24-22-28-25-27(37-33(8,9)38-28)19-20-29-26(7)18-21-30(35)32(29)31(17-16-23-34)39-41(13-4,14-5)15-6/h18,21,23,26-29,31-32H,10-17,19-20,22,24-25H2,1-9H3/t26?,27-,28+,29+,31?,32-/m1/s1 |
| InChIKey | GDDMCHHZUSFUPW-NUVHANISSA-N |
| XLogP | 8.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.03 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|