C26H45NOSi — CID 134886941
(1R,2S,3E,7E,11R,12R,15R)-2-[tert-butyl(dimethyl)silyl]oxy-4,8,11,12-tetramethylbicyclo[9.3.1]pentadeca-3,7-diene-15-carbonitrile (PubChem CID 134886941) has the molecular formula C26H45NOSi and a molecular weight of 415.74 g/mol. Its IUPAC name is (1R,2S,3E,7E,11R,12R,15R)-2-[tert-butyl(dimethyl)silyl]oxy-4,8,11,12-tetramethylbicyclo[9.3.1]pentadeca-3,7-diene-15-carbonitrile.
| Compound Name | (1R,2S,3E,7E,11R,12R,15R)-2-[tert-butyl(dimethyl)silyl]oxy-4,8,11,12-tetramethylbicyclo[9.3.1]pentadeca-3,7-diene-15-carbonitrile |
|---|---|
| PubChem CID | 134886941 |
| Molecular Formula | C26H45NOSi |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | (1R,2S,3E,7E,11R,12R,15R)-2-[tert-butyl(dimethyl)silyl]oxy-4,8,11,12-tetramethylbicyclo[9.3.1]pentadeca-3,7-diene-15-carbonitrile |
| SMILES | C/C1=C\[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC[C@@H](C)[C@@](C)(CC/C(C)=C/CC1)[C@@H]2C#N |
| InChI | InChI=1S/C26H45NOSi/c1-19-11-10-12-20(2)17-24(28-29(8,9)25(4,5)6)22-14-13-21(3)26(7,16-15-19)23(22)18-27/h11,17,21-24H,10,12-16H2,1-9H3/b19-11+,20-17+/t21-,22-,23-,24-,26-/m1/s1 |
| InChIKey | LXTLYXSWDMQCIO-FIXQRNRRSA-N |
| XLogP | 8.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|