C20H28O4 — CID 134887069
methyl (E,6R)-2-methyl-7-methylperoxy-6-[(1R,2S,3S,6R,7S)-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]hept-2-enoate (PubChem CID 134887069) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is methyl (E,6R)-2-methyl-7-methylperoxy-6-[(1R,2S,3S,6R,7S)-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]hept-2-enoate.
| Compound Name | methyl (E,6R)-2-methyl-7-methylperoxy-6-[(1R,2S,3S,6R,7S)-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]hept-2-enoate |
|---|---|
| PubChem CID | 134887069 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl (E,6R)-2-methyl-7-methylperoxy-6-[(1R,2S,3S,6R,7S)-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl]hept-2-enoate |
| SMILES | COOC[C@H](CC/C=C(\C)C(=O)OC)[C@H]1C=C[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C20H28O4/c1-13(20(21)22-2)5-4-6-16(12-24-23-3)18-10-9-17-14-7-8-15(11-14)19(17)18/h5,7-10,14-19H,4,6,11-12H2,1-3H3/b13-5+/t14-,15+,16+,17-,18-,19+/m1/s1 |
| InChIKey | VXOMYZGSLJPTQK-OYSNTPPCSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|