C20H40O2Si — CID 134887155
(2R,4E,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-4,6-dien-1-ol (PubChem CID 134887155) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (2R,4E,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-4,6-dien-1-ol.
| Compound Name | (2R,4E,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-4,6-dien-1-ol |
|---|---|
| PubChem CID | 134887155 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (2R,4E,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylundeca-4,6-dien-1-ol |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C/C[C@@H](C)CO |
| InChI | InChI=1S/C20H40O2Si/c1-10-19(22-23(8,9)20(5,6)7)18(4)14-16(2)12-11-13-17(3)15-21/h11-12,14,17-19,21H,10,13,15H2,1-9H3/b12-11+,16-14+/t17-,18-,19-/m1/s1 |
| InChIKey | OWDFKKPBKAUCCV-BDFTUYLMSA-N |
| XLogP | 5.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|