C25H48O3Si — CID 134887217
[(2S,3Z,5E)-2,4-dimethyl-6-[(2R,6R)-6-propan-2-yloxyoxan-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane (PubChem CID 134887217) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is [(2S,3Z,5E)-2,4-dimethyl-6-[(2R,6R)-6-propan-2-yloxyoxan-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2S,3Z,5E)-2,4-dimethyl-6-[(2R,6R)-6-propan-2-yloxyoxan-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134887217 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | [(2S,3Z,5E)-2,4-dimethyl-6-[(2R,6R)-6-propan-2-yloxyoxan-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
| SMILES | CC(=C/[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)/C=C/[C@H]1CCC[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C25H48O3Si/c1-18(2)27-25-13-11-12-24(28-25)15-14-22(9)16-23(10)17-26-29(19(3)4,20(5)6)21(7)8/h14-16,18-21,23-25H,11-13,17H2,1-10H3/b15-14+,22-16-/t23-,24+,25+/m0/s1 |
| InChIKey | BFVAJCFVWZPUSE-LHMACSPOSA-N |
| XLogP | 7.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|