C31H56OSi2 — CID 134887221
[3-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-7-methyl-3-triethylsilyloxyoct-6-en-1-ynyl]-trimethylsilane (PubChem CID 134887221) has the molecular formula C31H56OSi2 and a molecular weight of 500.96 g/mol. Its IUPAC name is [3-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-7-methyl-3-triethylsilyloxyoct-6-en-1-ynyl]-trimethylsilane.
| Compound Name | [3-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-7-methyl-3-triethylsilyloxyoct-6-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 134887221 |
| Molecular Formula | C31H56OSi2 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [3-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-7-methyl-3-triethylsilyloxyoct-6-en-1-ynyl]-trimethylsilane |
| SMILES | C=CC1=CC[C@H](C(C)C)[C@@]1(C)CCC(C#C[Si](C)(C)C)(CCC=C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H56OSi2/c1-13-28-19-20-29(27(7)8)30(28,9)22-23-31(21-17-18-26(5)6,24-25-33(10,11)12)32-34(14-2,15-3)16-4/h13,18-19,27,29H,1,14-17,20-23H2,2-12H3/t29-,30+,31?/m1/s1 |
| InChIKey | LIBYYKDOZYAZER-AWZUCMKVSA-N |
| XLogP | 9.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|