C30H52O6Si — CID 134887239
[(1S,3R,5S,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-5-hydroxy-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 134887239) has the molecular formula C30H52O6Si and a molecular weight of 536.83 g/mol. Its IUPAC name is [(1S,3R,5S,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-5-hydroxy-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,3R,5S,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-5-hydroxy-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 134887239 |
| Molecular Formula | C30H52O6Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | [(1S,3R,5S,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-5-hydroxy-3,7-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2[C@H]1[C@@H](CC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1)[C@@H](C)C[C@@H]2O |
| InChI | InChI=1S/C30H52O6Si/c1-10-19(3)29(33)35-26-14-18(2)13-24-25(31)15-20(4)23(28(24)26)12-11-21-16-22(17-27(32)34-21)36-37(8,9)30(5,6)7/h13,18-23,25-26,28,31H,10-12,14-17H2,1-9H3/t18-,19-,20-,21+,22+,23-,25-,26-,28+/m0/s1 |
| InChIKey | UABATHAMIHZTEB-MMNZLFKLSA-N |
| XLogP | 6.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|