C19H34O4Si — CID 134887316
methyl (Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5,5-dimethylnon-2-en-7-ynoate (PubChem CID 134887316) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl (Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5,5-dimethylnon-2-en-7-ynoate.
| Compound Name | methyl (Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5,5-dimethylnon-2-en-7-ynoate |
|---|---|
| PubChem CID | 134887316 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5,5-dimethylnon-2-en-7-ynoate |
| SMILES | COCC#C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C/C=C\C(=O)OC |
| InChI | InChI=1S/C19H34O4Si/c1-18(2,3)24(8,9)23-16(12-11-15-21-6)19(4,5)14-10-13-17(20)22-7/h10,13,16H,14-15H2,1-9H3/b13-10-/t16-/m0/s1 |
| InChIKey | FQNRIDSFQGXXOQ-DDKJEQMHSA-N |
| XLogP | 4.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|