C21H24O3 — CID 134887369
2-[6-(2-ethynyl-5-methoxyphenyl)hex-3-ynyl]-2-prop-1-en-2-yl-1,3-dioxolane (PubChem CID 134887369) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[6-(2-ethynyl-5-methoxyphenyl)hex-3-ynyl]-2-prop-1-en-2-yl-1,3-dioxolane.
| Compound Name | 2-[6-(2-ethynyl-5-methoxyphenyl)hex-3-ynyl]-2-prop-1-en-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 134887369 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[6-(2-ethynyl-5-methoxyphenyl)hex-3-ynyl]-2-prop-1-en-2-yl-1,3-dioxolane |
| SMILES | C#Cc1ccc(OC)cc1CCC#CCCC1(C(=C)C)OCCO1 |
| InChI | InChI=1S/C21H24O3/c1-5-18-11-12-20(22-4)16-19(18)10-8-6-7-9-13-21(17(2)3)23-14-15-24-21/h1,11-12,16H,2,8-10,13-15H2,3-4H3 |
| InChIKey | QHORTSHGMMCNHP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|