C7H12O3S — CID 134887497
2-[(2S,5S)-5-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]ethanol (PubChem CID 134887497) has the molecular formula C7H12O3S and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-[(2S,5S)-5-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]ethanol.
| Compound Name | 2-[(2S,5S)-5-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 134887497 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 2-[(2S,5S)-5-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl]ethanol |
| SMILES | C[C@H]1C=C[C@H](CCO)S1(=O)=O |
| InChI | InChI=1S/C7H12O3S/c1-6-2-3-7(4-5-8)11(6,9)10/h2-3,6-8H,4-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | JIRMWXWLBIQFOA-NKWVEPMBSA-N |
| XLogP | 0.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|