C18H24O5 — CID 134887561
diethyl (1R,10S)-13-oxatricyclo[8.2.1.02,9]trideca-2(9),11-diene-11,12-dicarboxylate (PubChem CID 134887561) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is diethyl (1R,10S)-13-oxatricyclo[8.2.1.02,9]trideca-2(9),11-diene-11,12-dicarboxylate.
| Compound Name | diethyl (1R,10S)-13-oxatricyclo[8.2.1.02,9]trideca-2(9),11-diene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 134887561 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | diethyl (1R,10S)-13-oxatricyclo[8.2.1.02,9]trideca-2(9),11-diene-11,12-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@H]2O[C@@H]1C1=C2CCCCCC1 |
| InChI | InChI=1S/C18H24O5/c1-3-21-17(19)13-14(18(20)22-4-2)16-12-10-8-6-5-7-9-11(12)15(13)23-16/h15-16H,3-10H2,1-2H3/t15-,16+ |
| InChIKey | KATBHCBQCKQMOC-IYBDPMFKSA-N |
| XLogP | 2.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|