C24H41IO3Si — CID 134887566
tert-butyl-[(E,2R,3R,4R)-6-iodo-4-methoxy-3,5-dimethyl-1-(2,4,6-trimethylphenoxy)hex-5-en-2-yl]oxy-dimethylsilane (PubChem CID 134887566) has the molecular formula C24H41IO3Si and a molecular weight of 532.58 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R,4R)-6-iodo-4-methoxy-3,5-dimethyl-1-(2,4,6-trimethylphenoxy)hex-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R,4R)-6-iodo-4-methoxy-3,5-dimethyl-1-(2,4,6-trimethylphenoxy)hex-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134887566 |
| Molecular Formula | C24H41IO3Si |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | tert-butyl-[(E,2R,3R,4R)-6-iodo-4-methoxy-3,5-dimethyl-1-(2,4,6-trimethylphenoxy)hex-5-en-2-yl]oxy-dimethylsilane |
| SMILES | CO[C@@H](/C(C)=C/I)[C@@H](C)[C@H](COc1c(C)cc(C)cc1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41IO3Si/c1-16-12-17(2)22(18(3)13-16)27-15-21(28-29(10,11)24(6,7)8)20(5)23(26-9)19(4)14-25/h12-14,20-21,23H,15H2,1-11H3/b19-14+/t20-,21-,23-/m0/s1 |
| InChIKey | KDYIBNAZNUYOCM-VGDJBCBLSA-N |
| XLogP | 7.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|